C19H21N — CID 23433463
2,2,4-trimethyl-6-(3-methylphenyl)-1H-quinoline (PubChem CID 23433463) has the molecular formula C19H21N and a molecular weight of 263.38 g/mol. Its IUPAC name is 2,2,4-trimethyl-6-(3-methylphenyl)-1H-quinoline.
| Compound Name | 2,2,4-trimethyl-6-(3-methylphenyl)-1H-quinoline |
|---|---|
| PubChem CID | 23433463 |
| Molecular Formula | C19H21N |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | 2,2,4-trimethyl-6-(3-methylphenyl)-1H-quinoline |
| SMILES | CC1=CC(C)(C)Nc2ccc(-c3cccc(C)c3)cc21 |
| InChI | InChI=1S/C19H21N/c1-13-6-5-7-15(10-13)16-8-9-18-17(11-16)14(2)12-19(3,4)20-18/h5-12,20H,1-4H3 |
| InChIKey | HSGCRQSRAKRGTQ-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |