C14H19N — CID 54180937
4-ethyl-2,2,6-trimethyl-1H-quinoline (PubChem CID 54180937) has the molecular formula C14H19N and a molecular weight of 201.31 g/mol. Its IUPAC name is 4-ethyl-2,2,6-trimethyl-1H-quinoline.
| Compound Name | 4-ethyl-2,2,6-trimethyl-1H-quinoline |
|---|---|
| PubChem CID | 54180937 |
| Molecular Formula | C14H19N |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | 4-ethyl-2,2,6-trimethyl-1H-quinoline |
| SMILES | CCC1=CC(C)(C)Nc2ccc(C)cc21 |
| InChI | InChI=1S/C14H19N/c1-5-11-9-14(3,4)15-13-7-6-10(2)8-12(11)13/h6-9,15H,5H2,1-4H3 |
| InChIKey | PBSVILSALXTKBN-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |