C17H25N — CID 66970055
2,2,4-trimethyl-6-pentyl-1H-quinoline (PubChem CID 66970055) has the molecular formula C17H25N and a molecular weight of 243.39 g/mol. Its IUPAC name is 2,2,4-trimethyl-6-pentyl-1H-quinoline.
| Compound Name | 2,2,4-trimethyl-6-pentyl-1H-quinoline |
|---|---|
| PubChem CID | 66970055 |
| Molecular Formula | C17H25N |
| Molecular Weight | 243.39 g/mol |
| Exact Mass | 243.20 |
| IUPAC Name | 2,2,4-trimethyl-6-pentyl-1H-quinoline |
| SMILES | CCCCCc1ccc2c(c1)C(C)=CC(C)(C)N2 |
| InChI | InChI=1S/C17H25N/c1-5-6-7-8-14-9-10-16-15(11-14)13(2)12-17(3,4)18-16/h9-12,18H,5-8H2,1-4H3 |
| InChIKey | RSWAMYBXJMXCNO-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.39 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|