C21H24ClNO — CID 58026827
5-(chloromethyl)-6-(2-methoxy-5-methylphenyl)-2,2,4-trimethyl-1H-quinoline (PubChem CID 58026827) has the molecular formula C21H24ClNO and a molecular weight of 341.88 g/mol. Its IUPAC name is 5-(chloromethyl)-6-(2-methoxy-5-methylphenyl)-2,2,4-trimethyl-1H-quinoline.
| Compound Name | 5-(chloromethyl)-6-(2-methoxy-5-methylphenyl)-2,2,4-trimethyl-1H-quinoline |
|---|---|
| PubChem CID | 58026827 |
| Molecular Formula | C21H24ClNO |
| Molecular Weight | 341.88 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | 5-(chloromethyl)-6-(2-methoxy-5-methylphenyl)-2,2,4-trimethyl-1H-quinoline |
| SMILES | COc1ccc(C)cc1-c1ccc2c(c1CCl)C(C)=CC(C)(C)N2 |
| InChI | InChI=1S/C21H24ClNO/c1-13-6-9-19(24-5)16(10-13)15-7-8-18-20(17(15)12-22)14(2)11-21(3,4)23-18/h6-11,23H,12H2,1-5H3 |
| InChIKey | BVKBIERNAWWIEK-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.88 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|