About 4-chloro-2-[(8-ethoxy-4,4-dimethyl-5H-dithiolo[3,4-c]quinolin-1-ylidene)amino]phenol
4-chloro-2-[(8-ethoxy-4,4-dimethyl-5H-dithiolo[3,4-c]quinolin-1-ylidene)amino]phenol (PubChem CID 3103758) has the molecular formula C20H19ClN2O2S2
and a molecular weight of 418.97 g/mol. Its IUPAC name is 4-chloro-2-[(8-ethoxy-4,4-dimethyl-5H-dithiolo[3,4-c]quinolin-1-ylidene)amino]phenol.
Molecular Properties
| Compound Name | 4-chloro-2-[(8-ethoxy-4,4-dimethyl-5H-dithiolo[3,4-c]quinolin-1-ylidene)amino]phenol |
| PubChem CID | 3103758 |
| Molecular Formula | C20H19ClN2O2S2 |
| Molecular Weight | 418.97 g/mol |
| Exact Mass | 418.06 |
| IUPAC Name | 4-chloro-2-[(8-ethoxy-4,4-dimethyl-5H-dithiolo[3,4-c]quinolin-1-ylidene)amino]phenol |
| SMILES | CCOc1ccc2c(c1)-c1c(ss/c1=N\c1cc(Cl)ccc1O)C(C)(C)N2 |
| InChI | InChI=1S/C20H19ClN2O2S2/c1-4-25-12-6-7-14-13(10-12)17-18(20(2,3)23-14)26-27-19(17)22-15-9-11(21)5-8-16(15)24/h5-10,23-24H,4H2,1-3H3/b22-19- |
| InChIKey | YWCPOXBJOWPTDW-QOCHGBHMSA-N |
| XLogP | 6.13 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 418.97 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'imine_phenol_A(3)', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-2-[(8-ethoxy-4,4-dimethyl-5H-dithiolo[3,4-c]quinolin-1-ylidene)amino]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-2-[(8-ethoxy-4,4-dimethyl-5H-dithiolo[3,4-c]quinolin-1-ylidene)amino]phenol?
The IUPAC name of 4-chloro-2-[(8-ethoxy-4,4-dimethyl-5H-dithiolo[3,4-c]quinolin-1-ylidene)amino]phenol (CID 3103758) is 4-chloro-2-[(8-ethoxy-4,4-dimethyl-5H-dithiolo[3,4-c]quinolin-1-ylidene)amino]phenol.
What is the SMILES notation for 4-chloro-2-[(8-ethoxy-4,4-dimethyl-5H-dithiolo[3,4-c]quinolin-1-ylidene)amino]phenol?
The canonical SMILES for 4-chloro-2-[(8-ethoxy-4,4-dimethyl-5H-dithiolo[3,4-c]quinolin-1-ylidene)amino]phenol is CCOc1ccc2c(c1)-c1c(ss/c1=N\c1cc(Cl)ccc1O)C(C)(C)N2.
What is the InChIKey of 4-chloro-2-[(8-ethoxy-4,4-dimethyl-5H-dithiolo[3,4-c]quinolin-1-ylidene)amino]phenol?
The InChIKey is YWCPOXBJOWPTDW-QOCHGBHMSA-N. The full InChI is InChI=1S/C20H19ClN2O2S2/c1-4-25-12-6-7-14-13(10-12)17-18(20(2,3)23-14)26-27-19(17)22-15-9-11(21)5-8-16(15)24/h5-10,23-24H,4H2,1-3H3/b22-19-.
What are the key properties of 4-chloro-2-[(8-ethoxy-4,4-dimethyl-5H-dithiolo[3,4-c]quinolin-1-ylidene)amino]phenol?
4-chloro-2-[(8-ethoxy-4,4-dimethyl-5H-dithiolo[3,4-c]quinolin-1-ylidene)amino]phenol has a molecular weight of 418.97 g/mol, XLogP of 6.13, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2-[(8-ethoxy-4,4-dimethyl-5H-dithiolo[3,4-c]quinolin-1-ylidene)amino]phenol is sourced from PubChem (CID 3103758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).