C26H23N3O2S2 — CID 23908660
N-[4-[(8-methoxy-4,4-dimethyl-5H-dithiolo[3,4-c]quinolin-1-ylidene)amino]phenyl]benzamide (PubChem CID 23908660) has the molecular formula C26H23N3O2S2 and a molecular weight of 473.62 g/mol. Its IUPAC name is N-[4-[(8-methoxy-4,4-dimethyl-5H-dithiolo[3,4-c]quinolin-1-ylidene)amino]phenyl]benzamide.
| Compound Name | N-[4-[(8-methoxy-4,4-dimethyl-5H-dithiolo[3,4-c]quinolin-1-ylidene)amino]phenyl]benzamide |
|---|---|
| PubChem CID | 23908660 |
| Molecular Formula | C26H23N3O2S2 |
| Molecular Weight | 473.62 g/mol |
| Exact Mass | 473.12 |
| IUPAC Name | N-[4-[(8-methoxy-4,4-dimethyl-5H-dithiolo[3,4-c]quinolin-1-ylidene)amino]phenyl]benzamide |
| SMILES | COc1ccc2c(c1)-c1c(ss/c1=N\c1ccc(NC(=O)c3ccccc3)cc1)C(C)(C)N2 |
| InChI | InChI=1S/C26H23N3O2S2/c1-26(2)23-22(20-15-19(31-3)13-14-21(20)29-26)25(33-32-23)28-18-11-9-17(10-12-18)27-24(30)16-7-5-4-6-8-16/h4-15,29H,1-3H3,(H,27,30)/b28-25- |
| InChIKey | QUMKUOWSMVIMRV-FVDSYPCUSA-N |
| XLogP | 6.63 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.62 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|