C13H20N2O — CID 176936552
6-ethoxy-3,3,4-trimethyl-1,2-dihydroquinoxaline (PubChem CID 176936552) has the molecular formula C13H20N2O and a molecular weight of 220.32 g/mol. Its IUPAC name is 6-ethoxy-3,3,4-trimethyl-1,2-dihydroquinoxaline.
| Compound Name | 6-ethoxy-3,3,4-trimethyl-1,2-dihydroquinoxaline |
|---|---|
| PubChem CID | 176936552 |
| Molecular Formula | C13H20N2O |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | 6-ethoxy-3,3,4-trimethyl-1,2-dihydroquinoxaline |
| SMILES | CCOc1ccc2c(c1)N(C)C(C)(C)CN2 |
| InChI | InChI=1S/C13H20N2O/c1-5-16-10-6-7-11-12(8-10)15(4)13(2,3)9-14-11/h6-8,14H,5,9H2,1-4H3 |
| InChIKey | NWLZGYIFHJHILI-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|