C15H22O2S — CID 79955357
3-(4-ethoxyphenyl)-4,4-dimethylthian-3-ol (PubChem CID 79955357) has the molecular formula C15H22O2S and a molecular weight of 266.41 g/mol. Its IUPAC name is 3-(4-ethoxyphenyl)-4,4-dimethylthian-3-ol.
| Compound Name | 3-(4-ethoxyphenyl)-4,4-dimethylthian-3-ol |
|---|---|
| PubChem CID | 79955357 |
| Molecular Formula | C15H22O2S |
| Molecular Weight | 266.41 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | 3-(4-ethoxyphenyl)-4,4-dimethylthian-3-ol |
| SMILES | CCOc1ccc(C2(O)CSCCC2(C)C)cc1 |
| InChI | InChI=1S/C15H22O2S/c1-4-17-13-7-5-12(6-8-13)15(16)11-18-10-9-14(15,2)3/h5-8,16H,4,9-11H2,1-3H3 |
| InChIKey | DUWVQKDUBPHUMY-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.41 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |