C16H25ClO2 — CID 67640778
1-(3-ethoxyphenyl)-2,2-dimethylcyclohexan-1-ol;hydrochloride (PubChem CID 67640778) has the molecular formula C16H25ClO2 and a molecular weight of 284.83 g/mol. Its IUPAC name is 1-(3-ethoxyphenyl)-2,2-dimethylcyclohexan-1-ol;hydrochloride.
| Compound Name | 1-(3-ethoxyphenyl)-2,2-dimethylcyclohexan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 67640778 |
| Molecular Formula | C16H25ClO2 |
| Molecular Weight | 284.83 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | 1-(3-ethoxyphenyl)-2,2-dimethylcyclohexan-1-ol;hydrochloride |
| SMILES | CCOc1cccc(C2(O)CCCCC2(C)C)c1.Cl |
| InChI | InChI=1S/C16H24O2.ClH/c1-4-18-14-9-7-8-13(12-14)16(17)11-6-5-10-15(16,2)3;/h7-9,12,17H,4-6,10-11H2,1-3H3;1H |
| InChIKey | JJCJIHBGWWQCCX-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.83 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |