C17H26O2 — CID 81314856
1-(3-ethoxyphenyl)-2,4,4-trimethylcyclohexan-1-ol (PubChem CID 81314856) has the molecular formula C17H26O2 and a molecular weight of 262.39 g/mol. Its IUPAC name is 1-(3-ethoxyphenyl)-2,4,4-trimethylcyclohexan-1-ol.
| Compound Name | 1-(3-ethoxyphenyl)-2,4,4-trimethylcyclohexan-1-ol |
|---|---|
| PubChem CID | 81314856 |
| Molecular Formula | C17H26O2 |
| Molecular Weight | 262.39 g/mol |
| Exact Mass | 262.19 |
| IUPAC Name | 1-(3-ethoxyphenyl)-2,4,4-trimethylcyclohexan-1-ol |
| SMILES | CCOc1cccc(C2(O)CCC(C)(C)CC2C)c1 |
| InChI | InChI=1S/C17H26O2/c1-5-19-15-8-6-7-14(11-15)17(18)10-9-16(3,4)12-13(17)2/h6-8,11,13,18H,5,9-10,12H2,1-4H3 |
| InChIKey | IMRSLEJNLPUGIL-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.39 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |