About 1-N,3-N-bis(3-chloro-4-methylphenyl)indene-1,3-diimine
1-N,3-N-bis(3-chloro-4-methylphenyl)indene-1,3-diimine (PubChem CID 94849572) has the molecular formula C23H18Cl2N2
and a molecular weight of 393.32 g/mol. Its IUPAC name is 1-N,3-N-bis(3-chloro-4-methylphenyl)indene-1,3-diimine.
Molecular Properties
| Compound Name | 1-N,3-N-bis(3-chloro-4-methylphenyl)indene-1,3-diimine |
| PubChem CID | 94849572 |
| Molecular Formula | C23H18Cl2N2 |
| Molecular Weight | 393.32 g/mol |
| Exact Mass | 392.08 |
| IUPAC Name | 1-N,3-N-bis(3-chloro-4-methylphenyl)indene-1,3-diimine |
| SMILES | Cc1ccc(/N=C2\C/C(=N\c3ccc(C)c(Cl)c3)c3ccccc32)cc1Cl |
| InChI | InChI=1S/C23H18Cl2N2/c1-14-7-9-16(11-20(14)24)26-22-13-23(19-6-4-3-5-18(19)22)27-17-10-8-15(2)21(25)12-17/h3-12H,13H2,1-2H3/b26-22+,27-23+ |
| InChIKey | SOASIOGZFDHVKO-GEECTANVSA-N |
| XLogP | 7.26 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 393.32 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1-N,3-N-bis(3-chloro-4-methylphenyl)indene-1,3-diimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N,3-N-bis(3-chloro-4-methylphenyl)indene-1,3-diimine?
The IUPAC name of 1-N,3-N-bis(3-chloro-4-methylphenyl)indene-1,3-diimine (CID 94849572) is 1-N,3-N-bis(3-chloro-4-methylphenyl)indene-1,3-diimine.
What is the SMILES notation for 1-N,3-N-bis(3-chloro-4-methylphenyl)indene-1,3-diimine?
The canonical SMILES for 1-N,3-N-bis(3-chloro-4-methylphenyl)indene-1,3-diimine is Cc1ccc(/N=C2\C/C(=N\c3ccc(C)c(Cl)c3)c3ccccc32)cc1Cl.
What is the InChIKey of 1-N,3-N-bis(3-chloro-4-methylphenyl)indene-1,3-diimine?
The InChIKey is SOASIOGZFDHVKO-GEECTANVSA-N. The full InChI is InChI=1S/C23H18Cl2N2/c1-14-7-9-16(11-20(14)24)26-22-13-23(19-6-4-3-5-18(19)22)27-17-10-8-15(2)21(25)12-17/h3-12H,13H2,1-2H3/b26-22+,27-23+.
What are the key properties of 1-N,3-N-bis(3-chloro-4-methylphenyl)indene-1,3-diimine?
1-N,3-N-bis(3-chloro-4-methylphenyl)indene-1,3-diimine has a molecular weight of 393.32 g/mol, XLogP of 7.26, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N,3-N-bis(3-chloro-4-methylphenyl)indene-1,3-diimine is sourced from PubChem (CID 94849572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).