C16H10ClNO2 — CID 54237267
2-(4-chlorophenyl)iminonaphthalene-1,4-dione (PubChem CID 54237267) has the molecular formula C16H10ClNO2 and a molecular weight of 283.71 g/mol. Its IUPAC name is 2-(4-chlorophenyl)iminonaphthalene-1,4-dione.
| Compound Name | 2-(4-chlorophenyl)iminonaphthalene-1,4-dione |
|---|---|
| PubChem CID | 54237267 |
| Molecular Formula | C16H10ClNO2 |
| Molecular Weight | 283.71 g/mol |
| Exact Mass | 283.04 |
| IUPAC Name | 2-(4-chlorophenyl)iminonaphthalene-1,4-dione |
| SMILES | O=C1C/C(=N\c2ccc(Cl)cc2)C(=O)c2ccccc21 |
| InChI | InChI=1S/C16H10ClNO2/c17-10-5-7-11(8-6-10)18-14-9-15(19)12-3-1-2-4-13(12)16(14)20/h1-8H,9H2/b18-14+ |
| InChIKey | QNLCYRRUMBUDHT-NBVRZTHBSA-N |
| XLogP | 3.88 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.71 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|