C20H19NO2 — CID 7157452
2-(4-phenylbutylimino)naphthalene-1,4-dione (PubChem CID 7157452) has the molecular formula C20H19NO2 and a molecular weight of 305.38 g/mol. Its IUPAC name is 2-(4-phenylbutylimino)naphthalene-1,4-dione.
| Compound Name | 2-(4-phenylbutylimino)naphthalene-1,4-dione |
|---|---|
| PubChem CID | 7157452 |
| Molecular Formula | C20H19NO2 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | 2-(4-phenylbutylimino)naphthalene-1,4-dione |
| SMILES | O=C1C/C(=N\CCCCc2ccccc2)C(=O)c2ccccc21 |
| InChI | InChI=1S/C20H19NO2/c22-19-14-18(20(23)17-12-5-4-11-16(17)19)21-13-7-6-10-15-8-2-1-3-9-15/h1-5,8-9,11-12H,6-7,10,13-14H2/b21-18+ |
| InChIKey | GQEAFQYNGYZGJX-DYTRJAOYSA-N |
| XLogP | 3.92 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|