C15H9IN2O2 — CID 91213111
2-[(5-iodo-2-pyridinyl)imino]naphthalene-1,4-dione (PubChem CID 91213111) has the molecular formula C15H9IN2O2 and a molecular weight of 376.15 g/mol. Its IUPAC name is 2-[(5-iodo-2-pyridinyl)imino]naphthalene-1,4-dione.
| Compound Name | 2-[(5-iodo-2-pyridinyl)imino]naphthalene-1,4-dione |
|---|---|
| PubChem CID | 91213111 |
| Molecular Formula | C15H9IN2O2 |
| Molecular Weight | 376.15 g/mol |
| Exact Mass | 375.97 |
| IUPAC Name | 2-[(5-iodo-2-pyridinyl)imino]naphthalene-1,4-dione |
| SMILES | O=C1C/C(=N\c2ccc(I)cn2)C(=O)c2ccccc21 |
| InChI | InChI=1S/C15H9IN2O2/c16-9-5-6-14(17-8-9)18-12-7-13(19)10-3-1-2-4-11(10)15(12)20/h1-6,8H,7H2/b18-12+ |
| InChIKey | JPIURWQFTAJNOE-LDADJPATSA-N |
| XLogP | 3.23 |
| TPSA | 59.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.15 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|