C20H14N2O4S — CID 123990950
6-naphthalen-2-ylimino-5,8-dioxonaphthalene-1-sulfonamide (PubChem CID 123990950) has the molecular formula C20H14N2O4S and a molecular weight of 378.41 g/mol. Its IUPAC name is 6-naphthalen-2-ylimino-5,8-dioxonaphthalene-1-sulfonamide.
| Compound Name | 6-naphthalen-2-ylimino-5,8-dioxonaphthalene-1-sulfonamide |
|---|---|
| PubChem CID | 123990950 |
| Molecular Formula | C20H14N2O4S |
| Molecular Weight | 378.41 g/mol |
| Exact Mass | 378.07 |
| IUPAC Name | 6-naphthalen-2-ylimino-5,8-dioxonaphthalene-1-sulfonamide |
| SMILES | NS(=O)(=O)c1cccc2c1C(=O)C/C(=N\c1ccc3ccccc3c1)C2=O |
| InChI | InChI=1S/C20H14N2O4S/c21-27(25,26)18-7-3-6-15-19(18)17(23)11-16(20(15)24)22-14-9-8-12-4-1-2-5-13(12)10-14/h1-10H,11H2,(H2,21,25,26)/b22-16+ |
| InChIKey | ZFCWRMIXCNHFKE-CJLVFECKSA-N |
| XLogP | 3.03 |
| TPSA | 106.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.41 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|