C22H20N2O4S — CID 144576091
ethane;6-(naphthalen-2-ylamino)-5,8-dioxonaphthalene-1-sulfonamide (PubChem CID 144576091) has the molecular formula C22H20N2O4S and a molecular weight of 408.48 g/mol. Its IUPAC name is ethane;6-(naphthalen-2-ylamino)-5,8-dioxonaphthalene-1-sulfonamide.
| Compound Name | ethane;6-(naphthalen-2-ylamino)-5,8-dioxonaphthalene-1-sulfonamide |
|---|---|
| PubChem CID | 144576091 |
| Molecular Formula | C22H20N2O4S |
| Molecular Weight | 408.48 g/mol |
| Exact Mass | 408.11 |
| IUPAC Name | ethane;6-(naphthalen-2-ylamino)-5,8-dioxonaphthalene-1-sulfonamide |
| SMILES | CC.NS(=O)(=O)c1cccc2c1C(=O)C=C(Nc1ccc3ccccc3c1)C2=O |
| InChI | InChI=1S/C20H14N2O4S.C2H6/c21-27(25,26)18-7-3-6-15-19(18)17(23)11-16(20(15)24)22-14-9-8-12-4-1-2-5-13(12)10-14;1-2/h1-11,22H,(H2,21,25,26);1-2H3 |
| InChIKey | BDQRIBGURSOIPM-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.48 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|