About acridine-1-sulfonamide;methane
acridine-1-sulfonamide;methane (PubChem CID 175223861) has the molecular formula C14H14N2O2S
and a molecular weight of 274.35 g/mol. Its IUPAC name is acridine-1-sulfonamide;methane.
Molecular Properties
| Compound Name | acridine-1-sulfonamide;methane |
| PubChem CID | 175223861 |
| Molecular Formula | C14H14N2O2S |
| Molecular Weight | 274.35 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | acridine-1-sulfonamide;methane |
| SMILES | C.NS(=O)(=O)c1cccc2nc3ccccc3cc12 |
| InChI | InChI=1S/C13H10N2O2S.CH4/c14-18(16,17)13-7-3-6-12-10(13)8-9-4-1-2-5-11(9)15-12;/h1-8H,(H2,14,16,17);1H4 |
| InChIKey | DFFFYSDBWMZWQS-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.35 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze acridine-1-sulfonamide;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acridine-1-sulfonamide;methane?
The IUPAC name of acridine-1-sulfonamide;methane (CID 175223861) is acridine-1-sulfonamide;methane.
What is the SMILES notation for acridine-1-sulfonamide;methane?
The canonical SMILES for acridine-1-sulfonamide;methane is C.NS(=O)(=O)c1cccc2nc3ccccc3cc12.
What is the InChIKey of acridine-1-sulfonamide;methane?
The InChIKey is DFFFYSDBWMZWQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10N2O2S.CH4/c14-18(16,17)13-7-3-6-12-10(13)8-9-4-1-2-5-11(9)15-12;/h1-8H,(H2,14,16,17);1H4.
What are the key properties of acridine-1-sulfonamide;methane?
acridine-1-sulfonamide;methane has a molecular weight of 274.35 g/mol, XLogP of 2.67, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acridine-1-sulfonamide;methane is sourced from PubChem (CID 175223861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).