C26H25NO2 — CID 135488377
(2E)-2-(1-hydroxybutylidene)-3-naphthalen-2-ylimino-5-phenylcyclohexan-1-one (PubChem CID 135488377) has the molecular formula C26H25NO2 and a molecular weight of 383.49 g/mol. Its IUPAC name is (2E)-2-(1-hydroxybutylidene)-3-naphthalen-2-ylimino-5-phenylcyclohexan-1-one.
| Compound Name | (2E)-2-(1-hydroxybutylidene)-3-naphthalen-2-ylimino-5-phenylcyclohexan-1-one |
|---|---|
| PubChem CID | 135488377 |
| Molecular Formula | C26H25NO2 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.19 |
| IUPAC Name | (2E)-2-(1-hydroxybutylidene)-3-naphthalen-2-ylimino-5-phenylcyclohexan-1-one |
| SMILES | CCC/C(O)=C1\C(=O)CC(c2ccccc2)C\C1=N/c1ccc2ccccc2c1 |
| InChI | InChI=1S/C26H25NO2/c1-2-8-24(28)26-23(16-21(17-25(26)29)18-9-4-3-5-10-18)27-22-14-13-19-11-6-7-12-20(19)15-22/h3-7,9-15,21,28H,2,8,16-17H2,1H3/b26-24+,27-23+ |
| InChIKey | OLDSTSCWRMQAGJ-FBQPMGKKSA-N |
| XLogP | 6.67 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|