C31H27NO3 — CID 135608875
(2E)-2-(1-hydroxy-2-naphthalen-1-ylethylidene)-3-(3-methoxyphenyl)imino-5-phenylcyclohexan-1-one (PubChem CID 135608875) has the molecular formula C31H27NO3 and a molecular weight of 461.56 g/mol. Its IUPAC name is (2E)-2-(1-hydroxy-2-naphthalen-1-ylethylidene)-3-(3-methoxyphenyl)imino-5-phenylcyclohexan-1-one.
| Compound Name | (2E)-2-(1-hydroxy-2-naphthalen-1-ylethylidene)-3-(3-methoxyphenyl)imino-5-phenylcyclohexan-1-one |
|---|---|
| PubChem CID | 135608875 |
| Molecular Formula | C31H27NO3 |
| Molecular Weight | 461.56 g/mol |
| Exact Mass | 461.20 |
| IUPAC Name | (2E)-2-(1-hydroxy-2-naphthalen-1-ylethylidene)-3-(3-methoxyphenyl)imino-5-phenylcyclohexan-1-one |
| SMILES | COc1cccc(/N=C2\CC(c3ccccc3)CC(=O)\C2=C(\O)Cc2cccc3ccccc23)c1 |
| InChI | InChI=1S/C31H27NO3/c1-35-26-15-8-14-25(20-26)32-28-17-24(21-9-3-2-4-10-21)19-30(34)31(28)29(33)18-23-13-7-12-22-11-5-6-16-27(22)23/h2-16,20,24,33H,17-19H2,1H3/b31-29+,32-28+ |
| InChIKey | OWBXFMJWGBWMDS-FUNWONRRSA-N |
| XLogP | 7.12 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.56 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|