C24H21NO2 — CID 135900679
(2E)-2-(1-hydroxy-2-naphthalen-1-ylethylidene)-3-imino-5-phenylcyclohexan-1-one (PubChem CID 135900679) has the molecular formula C24H21NO2 and a molecular weight of 355.44 g/mol. Its IUPAC name is (2E)-2-(1-hydroxy-2-naphthalen-1-ylethylidene)-3-imino-5-phenylcyclohexan-1-one.
| Compound Name | (2E)-2-(1-hydroxy-2-naphthalen-1-ylethylidene)-3-imino-5-phenylcyclohexan-1-one |
|---|---|
| PubChem CID | 135900679 |
| Molecular Formula | C24H21NO2 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | (2E)-2-(1-hydroxy-2-naphthalen-1-ylethylidene)-3-imino-5-phenylcyclohexan-1-one |
| SMILES | [H]/N=C1\CC(c2ccccc2)CC(=O)\C1=C(\O)Cc1cccc2ccccc12 |
| InChI | InChI=1S/C24H21NO2/c25-21-13-19(16-7-2-1-3-8-16)15-23(27)24(21)22(26)14-18-11-6-10-17-9-4-5-12-20(17)18/h1-12,19,25-26H,13-15H2/b24-22+,25-21+ |
| InChIKey | HRJRCLFVPLWLLZ-AORRCUJUSA-N |
| XLogP | 5.36 |
| TPSA | 61.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|