C24H26N2O4 — CID 135896115
3-[(3Z)-3-hydroxy-3-(2-imino-6-oxo-4-phenylcyclohexylidene)propyl]-6,6-dimethyl-5,7-dihydro-1,2-benzoxazol-4-one (PubChem CID 135896115) has the molecular formula C24H26N2O4 and a molecular weight of 406.48 g/mol. Its IUPAC name is 3-[(3Z)-3-hydroxy-3-(2-imino-6-oxo-4-phenylcyclohexylidene)propyl]-6,6-dimethyl-5,7-dihydro-1,2-benzoxazol-4-one.
| Compound Name | 3-[(3Z)-3-hydroxy-3-(2-imino-6-oxo-4-phenylcyclohexylidene)propyl]-6,6-dimethyl-5,7-dihydro-1,2-benzoxazol-4-one |
|---|---|
| PubChem CID | 135896115 |
| Molecular Formula | C24H26N2O4 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | 3-[(3Z)-3-hydroxy-3-(2-imino-6-oxo-4-phenylcyclohexylidene)propyl]-6,6-dimethyl-5,7-dihydro-1,2-benzoxazol-4-one |
| SMILES | [H]/N=C1\CC(c2ccccc2)CC(=O)\C1=C(/O)CCc1noc2c1C(=O)CC(C)(C)C2 |
| InChI | InChI=1S/C24H26N2O4/c1-24(2)12-20(29)23-17(26-30-21(23)13-24)8-9-18(27)22-16(25)10-15(11-19(22)28)14-6-4-3-5-7-14/h3-7,15,25,27H,8-13H2,1-2H3/b22-18-,25-16+ |
| InChIKey | SXZMCWXWWOIOCA-BXOHQCGVSA-N |
| XLogP | 4.74 |
| TPSA | 104.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|