C31H30N2O6 — CID 135627572
3-[[(2Z)-2-[1-hydroxy-3-(4-oxo-6-phenyl-6,7-dihydro-5H-1,2-benzoxazol-3-yl)propylidene]-3-oxo-5-phenylcyclohexylidene]amino]propanoic acid (PubChem CID 135627572) has the molecular formula C31H30N2O6 and a molecular weight of 526.59 g/mol. Its IUPAC name is 3-[[(2Z)-2-[1-hydroxy-3-(4-oxo-6-phenyl-6,7-dihydro-5H-1,2-benzoxazol-3-yl)propylidene]-3-oxo-5-phenylcyclohexylidene]amino]propanoic acid.
| Compound Name | 3-[[(2Z)-2-[1-hydroxy-3-(4-oxo-6-phenyl-6,7-dihydro-5H-1,2-benzoxazol-3-yl)propylidene]-3-oxo-5-phenylcyclohexylidene]amino]propanoic acid |
|---|---|
| PubChem CID | 135627572 |
| Molecular Formula | C31H30N2O6 |
| Molecular Weight | 526.59 g/mol |
| Exact Mass | 526.21 |
| IUPAC Name | 3-[[(2Z)-2-[1-hydroxy-3-(4-oxo-6-phenyl-6,7-dihydro-5H-1,2-benzoxazol-3-yl)propylidene]-3-oxo-5-phenylcyclohexylidene]amino]propanoic acid |
| SMILES | O=C(O)CC/N=C1\CC(c2ccccc2)CC(=O)\C1=C(/O)CCc1noc2c1C(=O)CC(c1ccccc1)C2 |
| InChI | InChI=1S/C31H30N2O6/c34-25(12-11-23-31-27(36)17-22(18-28(31)39-33-23)20-9-5-2-6-10-20)30-24(32-14-13-29(37)38)15-21(16-26(30)35)19-7-3-1-4-8-19/h1-10,21-22,34H,11-18H2,(H,37,38)/b30-25-,32-24+ |
| InChIKey | NARTWNBRRJNQCZ-CEUDYNAFSA-N |
| XLogP | 5.39 |
| TPSA | 130.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.59 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|