C34H32N2O4 — CID 135540275
3-[3-(4,4-dimethyl-2-naphthalen-2-ylimino-6-oxocyclohexylidene)-3-hydroxypropyl]-6-phenyl-6,7-dihydro-5H-1,2-benzoxazol-4-one (PubChem CID 135540275) has the molecular formula C34H32N2O4 and a molecular weight of 532.64 g/mol. Its IUPAC name is 3-[3-(4,4-dimethyl-2-naphthalen-2-ylimino-6-oxocyclohexylidene)-3-hydroxypropyl]-6-phenyl-6,7-dihydro-5H-1,2-benzoxazol-4-one.
| Compound Name | 3-[3-(4,4-dimethyl-2-naphthalen-2-ylimino-6-oxocyclohexylidene)-3-hydroxypropyl]-6-phenyl-6,7-dihydro-5H-1,2-benzoxazol-4-one |
|---|---|
| PubChem CID | 135540275 |
| Molecular Formula | C34H32N2O4 |
| Molecular Weight | 532.64 g/mol |
| Exact Mass | 532.24 |
| IUPAC Name | 3-[3-(4,4-dimethyl-2-naphthalen-2-ylimino-6-oxocyclohexylidene)-3-hydroxypropyl]-6-phenyl-6,7-dihydro-5H-1,2-benzoxazol-4-one |
| SMILES | CC1(C)CC(=O)C(=C(O)CCc2noc3c2C(=O)CC(c2ccccc2)C3)/C(=N/c2ccc3ccccc3c2)C1 |
| InChI | InChI=1S/C34H32N2O4/c1-34(2)19-27(35-25-13-12-22-10-6-7-11-23(22)16-25)32(30(39)20-34)28(37)15-14-26-33-29(38)17-24(18-31(33)40-36-26)21-8-4-3-5-9-21/h3-13,16,24,37H,14-15,17-20H2,1-2H3/b32-28?,35-27+ |
| InChIKey | SODXZUCIOVINGZ-VCHFCMGJSA-N |
| XLogP | 7.65 |
| TPSA | 92.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.64 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|