C30H29BrN2O4 — CID 135540270
3-[3-[2-(4-bromophenyl)imino-4,4-dimethyl-6-oxocyclohexylidene]-3-hydroxypropyl]-6-phenyl-6,7-dihydro-5H-1,2-benzoxazol-4-one (PubChem CID 135540270) has the molecular formula C30H29BrN2O4 and a molecular weight of 561.48 g/mol. Its IUPAC name is 3-[3-[2-(4-bromophenyl)imino-4,4-dimethyl-6-oxocyclohexylidene]-3-hydroxypropyl]-6-phenyl-6,7-dihydro-5H-1,2-benzoxazol-4-one.
| Compound Name | 3-[3-[2-(4-bromophenyl)imino-4,4-dimethyl-6-oxocyclohexylidene]-3-hydroxypropyl]-6-phenyl-6,7-dihydro-5H-1,2-benzoxazol-4-one |
|---|---|
| PubChem CID | 135540270 |
| Molecular Formula | C30H29BrN2O4 |
| Molecular Weight | 561.48 g/mol |
| Exact Mass | 560.13 |
| IUPAC Name | 3-[3-[2-(4-bromophenyl)imino-4,4-dimethyl-6-oxocyclohexylidene]-3-hydroxypropyl]-6-phenyl-6,7-dihydro-5H-1,2-benzoxazol-4-one |
| SMILES | CC1(C)CC(=O)C(=C(O)CCc2noc3c2C(=O)CC(c2ccccc2)C3)/C(=N/c2ccc(Br)cc2)C1 |
| InChI | InChI=1S/C30H29BrN2O4/c1-30(2)16-23(32-21-10-8-20(31)9-11-21)28(26(36)17-30)24(34)13-12-22-29-25(35)14-19(15-27(29)37-33-22)18-6-4-3-5-7-18/h3-11,19,34H,12-17H2,1-2H3/b28-24?,32-23+ |
| InChIKey | DLVOVQOJWGQUAF-DUBASTNISA-N |
| XLogP | 7.26 |
| TPSA | 92.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.48 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|