C31H32N2O4 — CID 135627497
3-[(3E)-3-(2-benzylimino-6-oxo-4-phenylcyclohexylidene)-3-hydroxypropyl]-6,6-dimethyl-5,7-dihydro-1,2-benzoxazol-4-one (PubChem CID 135627497) has the molecular formula C31H32N2O4 and a molecular weight of 496.61 g/mol. Its IUPAC name is 3-[(3E)-3-(2-benzylimino-6-oxo-4-phenylcyclohexylidene)-3-hydroxypropyl]-6,6-dimethyl-5,7-dihydro-1,2-benzoxazol-4-one.
| Compound Name | 3-[(3E)-3-(2-benzylimino-6-oxo-4-phenylcyclohexylidene)-3-hydroxypropyl]-6,6-dimethyl-5,7-dihydro-1,2-benzoxazol-4-one |
|---|---|
| PubChem CID | 135627497 |
| Molecular Formula | C31H32N2O4 |
| Molecular Weight | 496.61 g/mol |
| Exact Mass | 496.24 |
| IUPAC Name | 3-[(3E)-3-(2-benzylimino-6-oxo-4-phenylcyclohexylidene)-3-hydroxypropyl]-6,6-dimethyl-5,7-dihydro-1,2-benzoxazol-4-one |
| SMILES | CC1(C)CC(=O)c2c(CC/C(O)=C3\C(=O)CC(c4ccccc4)C\C3=N/Cc3ccccc3)noc2C1 |
| InChI | InChI=1S/C31H32N2O4/c1-31(2)17-27(36)30-23(33-37-28(30)18-31)13-14-25(34)29-24(32-19-20-9-5-3-6-10-20)15-22(16-26(29)35)21-11-7-4-8-12-21/h3-12,22,34H,13-19H2,1-2H3/b29-25+,32-24+ |
| InChIKey | JYIHNSWWHUHEDW-AGVJJVKWSA-N |
| XLogP | 6.36 |
| TPSA | 92.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.61 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|