C25H28N2O4 — CID 135933121
3-[(3Z)-3-hydroxy-3-(2-oxo-4-phenyl-6-propyliminocyclohexylidene)propyl]-6,7-dihydro-5H-1,2-benzoxazol-4-one (PubChem CID 135933121) has the molecular formula C25H28N2O4 and a molecular weight of 420.51 g/mol. Its IUPAC name is 3-[(3Z)-3-hydroxy-3-(2-oxo-4-phenyl-6-propyliminocyclohexylidene)propyl]-6,7-dihydro-5H-1,2-benzoxazol-4-one.
| Compound Name | 3-[(3Z)-3-hydroxy-3-(2-oxo-4-phenyl-6-propyliminocyclohexylidene)propyl]-6,7-dihydro-5H-1,2-benzoxazol-4-one |
|---|---|
| PubChem CID | 135933121 |
| Molecular Formula | C25H28N2O4 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | 3-[(3Z)-3-hydroxy-3-(2-oxo-4-phenyl-6-propyliminocyclohexylidene)propyl]-6,7-dihydro-5H-1,2-benzoxazol-4-one |
| SMILES | CCC/N=C1\CC(c2ccccc2)CC(=O)\C1=C(/O)CCc1noc2c1C(=O)CCC2 |
| InChI | InChI=1S/C25H28N2O4/c1-2-13-26-19-14-17(16-7-4-3-5-8-16)15-22(30)24(19)21(29)12-11-18-25-20(28)9-6-10-23(25)31-27-18/h3-5,7-8,17,29H,2,6,9-15H2,1H3/b24-21-,26-19+ |
| InChIKey | YEJQRBNMIOGIRA-NNAJWQEXSA-N |
| XLogP | 4.94 |
| TPSA | 92.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|