C22H22N2O4 — CID 135867687
3-[(3Z)-3-hydroxy-3-(2-oxo-6-phenyliminocyclohexylidene)propyl]-6,7-dihydro-5H-1,2-benzoxazol-4-one (PubChem CID 135867687) has the molecular formula C22H22N2O4 and a molecular weight of 378.43 g/mol. Its IUPAC name is 3-[(3Z)-3-hydroxy-3-(2-oxo-6-phenyliminocyclohexylidene)propyl]-6,7-dihydro-5H-1,2-benzoxazol-4-one.
| Compound Name | 3-[(3Z)-3-hydroxy-3-(2-oxo-6-phenyliminocyclohexylidene)propyl]-6,7-dihydro-5H-1,2-benzoxazol-4-one |
|---|---|
| PubChem CID | 135867687 |
| Molecular Formula | C22H22N2O4 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | 3-[(3Z)-3-hydroxy-3-(2-oxo-6-phenyliminocyclohexylidene)propyl]-6,7-dihydro-5H-1,2-benzoxazol-4-one |
| SMILES | O=C1CCCC(=N\c2ccccc2)/C1=C(/O)CCc1noc2c1C(=O)CCC2 |
| InChI | InChI=1S/C22H22N2O4/c25-17-9-4-8-15(23-14-6-2-1-3-7-14)21(17)19(27)13-12-16-22-18(26)10-5-11-20(22)28-24-16/h1-3,6-7,27H,4-5,8-13H2/b21-19-,23-15+ |
| InChIKey | YKVSBRXEVMGZFW-CFXRXDTFSA-N |
| XLogP | 4.46 |
| TPSA | 92.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|