C24H25N3O6 — CID 135627358
3-[(3Z)-3-hydroxy-3-[2-(4-nitrophenyl)imino-6-oxocyclohexylidene]propyl]-6,6-dimethyl-5,7-dihydro-1,2-benzoxazol-4-one (PubChem CID 135627358) has the molecular formula C24H25N3O6 and a molecular weight of 451.48 g/mol. Its IUPAC name is 3-[(3Z)-3-hydroxy-3-[2-(4-nitrophenyl)imino-6-oxocyclohexylidene]propyl]-6,6-dimethyl-5,7-dihydro-1,2-benzoxazol-4-one.
| Compound Name | 3-[(3Z)-3-hydroxy-3-[2-(4-nitrophenyl)imino-6-oxocyclohexylidene]propyl]-6,6-dimethyl-5,7-dihydro-1,2-benzoxazol-4-one |
|---|---|
| PubChem CID | 135627358 |
| Molecular Formula | C24H25N3O6 |
| Molecular Weight | 451.48 g/mol |
| Exact Mass | 451.17 |
| IUPAC Name | 3-[(3Z)-3-hydroxy-3-[2-(4-nitrophenyl)imino-6-oxocyclohexylidene]propyl]-6,6-dimethyl-5,7-dihydro-1,2-benzoxazol-4-one |
| SMILES | CC1(C)CC(=O)c2c(CC/C(O)=C3/C(=O)CCC/C3=N\c3ccc([N+](=O)[O-])cc3)noc2C1 |
| InChI | InChI=1S/C24H25N3O6/c1-24(2)12-20(30)23-17(26-33-21(23)13-24)10-11-19(29)22-16(4-3-5-18(22)28)25-14-6-8-15(9-7-14)27(31)32/h6-9,29H,3-5,10-13H2,1-2H3/b22-19-,25-16+ |
| InChIKey | UWZPYHYVRIHROK-FSKHBIKESA-N |
| XLogP | 5.01 |
| TPSA | 135.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.48 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|