C26H30N2O6 — CID 135627320
3-[(3E)-3-[2-[2-(3,4-dimethoxyphenyl)ethylimino]-6-oxocyclohexylidene]-3-hydroxypropyl]-6,7-dihydro-5H-1,2-benzoxazol-4-one (PubChem CID 135627320) has the molecular formula C26H30N2O6 and a molecular weight of 466.53 g/mol. Its IUPAC name is 3-[(3E)-3-[2-[2-(3,4-dimethoxyphenyl)ethylimino]-6-oxocyclohexylidene]-3-hydroxypropyl]-6,7-dihydro-5H-1,2-benzoxazol-4-one.
| Compound Name | 3-[(3E)-3-[2-[2-(3,4-dimethoxyphenyl)ethylimino]-6-oxocyclohexylidene]-3-hydroxypropyl]-6,7-dihydro-5H-1,2-benzoxazol-4-one |
|---|---|
| PubChem CID | 135627320 |
| Molecular Formula | C26H30N2O6 |
| Molecular Weight | 466.53 g/mol |
| Exact Mass | 466.21 |
| IUPAC Name | 3-[(3E)-3-[2-[2-(3,4-dimethoxyphenyl)ethylimino]-6-oxocyclohexylidene]-3-hydroxypropyl]-6,7-dihydro-5H-1,2-benzoxazol-4-one |
| SMILES | COc1ccc(CC/N=C2\CCCC(=O)\C2=C(\O)CCc2noc3c2C(=O)CCC3)cc1OC |
| InChI | InChI=1S/C26H30N2O6/c1-32-22-12-9-16(15-24(22)33-2)13-14-27-17-5-3-6-19(29)25(17)21(31)11-10-18-26-20(30)7-4-8-23(26)34-28-18/h9,12,15,31H,3-8,10-11,13-14H2,1-2H3/b25-21+,27-17+ |
| InChIKey | PMYTZOMZYZCVBW-DWSDKPIQSA-N |
| XLogP | 4.39 |
| TPSA | 111.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.53 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|