C24H24N2O6 — CID 135627391
2-[[(2Z)-2-[1-hydroxy-3-(4-oxo-6-phenyl-6,7-dihydro-5H-1,2-benzoxazol-3-yl)propylidene]-3-oxocyclohexylidene]amino]acetic acid (PubChem CID 135627391) has the molecular formula C24H24N2O6 and a molecular weight of 436.46 g/mol. Its IUPAC name is 2-[[(2Z)-2-[1-hydroxy-3-(4-oxo-6-phenyl-6,7-dihydro-5H-1,2-benzoxazol-3-yl)propylidene]-3-oxocyclohexylidene]amino]acetic acid.
| Compound Name | 2-[[(2Z)-2-[1-hydroxy-3-(4-oxo-6-phenyl-6,7-dihydro-5H-1,2-benzoxazol-3-yl)propylidene]-3-oxocyclohexylidene]amino]acetic acid |
|---|---|
| PubChem CID | 135627391 |
| Molecular Formula | C24H24N2O6 |
| Molecular Weight | 436.46 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | 2-[[(2Z)-2-[1-hydroxy-3-(4-oxo-6-phenyl-6,7-dihydro-5H-1,2-benzoxazol-3-yl)propylidene]-3-oxocyclohexylidene]amino]acetic acid |
| SMILES | O=C(O)C/N=C1\CCCC(=O)\C1=C(/O)CCc1noc2c1C(=O)CC(c1ccccc1)C2 |
| InChI | InChI=1S/C24H24N2O6/c27-18-8-4-7-16(25-13-22(30)31)23(18)19(28)10-9-17-24-20(29)11-15(12-21(24)32-26-17)14-5-2-1-3-6-14/h1-3,5-6,15,28H,4,7-13H2,(H,30,31)/b23-19-,25-16+ |
| InChIKey | ZAEVGWBHABJOCL-AGGJPKSESA-N |
| XLogP | 3.61 |
| TPSA | 130.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.46 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|