C35H32N2O5 — CID 135540329
3-[3-hydroxy-3-[2-(3-methoxyphenyl)imino-6-oxo-4-phenylcyclohexylidene]propyl]-6-phenyl-6,7-dihydro-5H-1,2-benzoxazol-4-one (PubChem CID 135540329) has the molecular formula C35H32N2O5 and a molecular weight of 560.65 g/mol. Its IUPAC name is 3-[3-hydroxy-3-[2-(3-methoxyphenyl)imino-6-oxo-4-phenylcyclohexylidene]propyl]-6-phenyl-6,7-dihydro-5H-1,2-benzoxazol-4-one.
| Compound Name | 3-[3-hydroxy-3-[2-(3-methoxyphenyl)imino-6-oxo-4-phenylcyclohexylidene]propyl]-6-phenyl-6,7-dihydro-5H-1,2-benzoxazol-4-one |
|---|---|
| PubChem CID | 135540329 |
| Molecular Formula | C35H32N2O5 |
| Molecular Weight | 560.65 g/mol |
| Exact Mass | 560.23 |
| IUPAC Name | 3-[3-hydroxy-3-[2-(3-methoxyphenyl)imino-6-oxo-4-phenylcyclohexylidene]propyl]-6-phenyl-6,7-dihydro-5H-1,2-benzoxazol-4-one |
| SMILES | COc1cccc(/N=C2\CC(c3ccccc3)CC(=O)C2=C(O)CCc2noc3c2C(=O)CC(c2ccccc2)C3)c1 |
| InChI | InChI=1S/C35H32N2O5/c1-41-27-14-8-13-26(21-27)36-29-17-24(22-9-4-2-5-10-22)18-31(39)34(29)30(38)16-15-28-35-32(40)19-25(20-33(35)42-37-28)23-11-6-3-7-12-23/h2-14,21,24-25,38H,15-20H2,1H3/b34-30?,36-29+ |
| InChIKey | ITYKPKMRIUGHPI-ICOWOFAGSA-N |
| XLogP | 7.26 |
| TPSA | 101.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.65 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|