C21H23NO2 — CID 135526202
2-(1-hydroxy-2-naphthalen-1-ylethylidene)-3-propan-2-yliminocyclohexan-1-one (PubChem CID 135526202) has the molecular formula C21H23NO2 and a molecular weight of 321.42 g/mol. Its IUPAC name is 2-(1-hydroxy-2-naphthalen-1-ylethylidene)-3-propan-2-yliminocyclohexan-1-one.
| Compound Name | 2-(1-hydroxy-2-naphthalen-1-ylethylidene)-3-propan-2-yliminocyclohexan-1-one |
|---|---|
| PubChem CID | 135526202 |
| Molecular Formula | C21H23NO2 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | 2-(1-hydroxy-2-naphthalen-1-ylethylidene)-3-propan-2-yliminocyclohexan-1-one |
| SMILES | CC(C)/N=C1\CCCC(=O)C1=C(O)Cc1cccc2ccccc12 |
| InChI | InChI=1S/C21H23NO2/c1-14(2)22-18-11-6-12-19(23)21(18)20(24)13-16-9-5-8-15-7-3-4-10-17(15)16/h3-5,7-10,14,24H,6,11-13H2,1-2H3/b21-20?,22-18+ |
| InChIKey | WIFVCVMOVUZJGJ-ZZWRXZPRSA-N |
| XLogP | 4.80 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|