C24H27NO4 — CID 135526231
6-[[2-(1-hydroxy-2-naphthalen-1-ylethylidene)-3-oxocyclohexylidene]amino]hexanoic acid (PubChem CID 135526231) has the molecular formula C24H27NO4 and a molecular weight of 393.48 g/mol. Its IUPAC name is 6-[[2-(1-hydroxy-2-naphthalen-1-ylethylidene)-3-oxocyclohexylidene]amino]hexanoic acid.
| Compound Name | 6-[[2-(1-hydroxy-2-naphthalen-1-ylethylidene)-3-oxocyclohexylidene]amino]hexanoic acid |
|---|---|
| PubChem CID | 135526231 |
| Molecular Formula | C24H27NO4 |
| Molecular Weight | 393.48 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | 6-[[2-(1-hydroxy-2-naphthalen-1-ylethylidene)-3-oxocyclohexylidene]amino]hexanoic acid |
| SMILES | O=C(O)CCCCC/N=C1\CCCC(=O)C1=C(O)Cc1cccc2ccccc12 |
| InChI | InChI=1S/C24H27NO4/c26-21-13-7-12-20(25-15-5-1-2-14-23(28)29)24(21)22(27)16-18-10-6-9-17-8-3-4-11-19(17)18/h3-4,6,8-11,27H,1-2,5,7,12-16H2,(H,28,29)/b24-22?,25-20+ |
| InChIKey | PESDMUXQUYNJET-YUAOOBQDSA-N |
| XLogP | 5.03 |
| TPSA | 86.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.48 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|