C42H44N2O4 — CID 135526230
2-(1-hydroxy-2-naphthalen-1-ylethylidene)-3-[6-[[2-(1-hydroxy-2-naphthalen-1-ylethylidene)-3-oxocyclohexylidene]amino]hexylimino]cyclohexan-1-one (PubChem CID 135526230) has the molecular formula C42H44N2O4 and a molecular weight of 640.82 g/mol. Its IUPAC name is 2-(1-hydroxy-2-naphthalen-1-ylethylidene)-3-[6-[[2-(1-hydroxy-2-naphthalen-1-ylethylidene)-3-oxocyclohexylidene]amino]hexylimino]cyclohexan-1-one.
| Compound Name | 2-(1-hydroxy-2-naphthalen-1-ylethylidene)-3-[6-[[2-(1-hydroxy-2-naphthalen-1-ylethylidene)-3-oxocyclohexylidene]amino]hexylimino]cyclohexan-1-one |
|---|---|
| PubChem CID | 135526230 |
| Molecular Formula | C42H44N2O4 |
| Molecular Weight | 640.82 g/mol |
| Exact Mass | 640.33 |
| IUPAC Name | 2-(1-hydroxy-2-naphthalen-1-ylethylidene)-3-[6-[[2-(1-hydroxy-2-naphthalen-1-ylethylidene)-3-oxocyclohexylidene]amino]hexylimino]cyclohexan-1-one |
| SMILES | O=C1CCC/C(=N\CCCCCC/N=C2\CCCC(=O)C2=C(O)Cc2cccc3ccccc23)C1=C(O)Cc1cccc2ccccc12 |
| InChI | InChI=1S/C42H44N2O4/c45-37-23-11-21-35(41(37)39(47)27-31-17-9-15-29-13-3-5-19-33(29)31)43-25-7-1-2-8-26-44-36-22-12-24-38(46)42(36)40(48)28-32-18-10-16-30-14-4-6-20-34(30)32/h3-6,9-10,13-20,47-48H,1-2,7-8,11-12,21-28H2/b41-39?,42-40?,43-35+,44-36+ |
| InChIKey | JIMUVOGXTOGDMA-AUIMOMRFSA-N |
| XLogP | 9.35 |
| TPSA | 99.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.82 |
| LogP ≤ 5 | 9.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|