C25H23NO3 — CID 135526210
2-(1-hydroxy-2-naphthalen-1-ylethylidene)-3-(3-methoxyphenyl)iminocyclohexan-1-one (PubChem CID 135526210) has the molecular formula C25H23NO3 and a molecular weight of 385.46 g/mol. Its IUPAC name is 2-(1-hydroxy-2-naphthalen-1-ylethylidene)-3-(3-methoxyphenyl)iminocyclohexan-1-one.
| Compound Name | 2-(1-hydroxy-2-naphthalen-1-ylethylidene)-3-(3-methoxyphenyl)iminocyclohexan-1-one |
|---|---|
| PubChem CID | 135526210 |
| Molecular Formula | C25H23NO3 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | 2-(1-hydroxy-2-naphthalen-1-ylethylidene)-3-(3-methoxyphenyl)iminocyclohexan-1-one |
| SMILES | COc1cccc(/N=C2\CCCC(=O)C2=C(O)Cc2cccc3ccccc23)c1 |
| InChI | InChI=1S/C25H23NO3/c1-29-20-11-5-10-19(16-20)26-22-13-6-14-23(27)25(22)24(28)15-18-9-4-8-17-7-2-3-12-21(17)18/h2-5,7-12,16,28H,6,13-15H2,1H3/b25-24?,26-22+ |
| InChIKey | HKCSIROURPOPGK-SRNOCHJBSA-N |
| XLogP | 5.73 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|