C15H16O4 — CID 13464735
2-[1-hydroxy-2-(3-methoxyphenyl)ethylidene]cyclohexane-1,3-dione (PubChem CID 13464735) has the molecular formula C15H16O4 and a molecular weight of 260.29 g/mol. Its IUPAC name is 2-[1-hydroxy-2-(3-methoxyphenyl)ethylidene]cyclohexane-1,3-dione.
| Compound Name | 2-[1-hydroxy-2-(3-methoxyphenyl)ethylidene]cyclohexane-1,3-dione |
|---|---|
| PubChem CID | 13464735 |
| Molecular Formula | C15H16O4 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | 2-[1-hydroxy-2-(3-methoxyphenyl)ethylidene]cyclohexane-1,3-dione |
| SMILES | COc1cccc(CC(O)=C2C(=O)CCCC2=O)c1 |
| InChI | InChI=1S/C15H16O4/c1-19-11-5-2-4-10(8-11)9-14(18)15-12(16)6-3-7-13(15)17/h2,4-5,8,18H,3,6-7,9H2,1H3 |
| InChIKey | MVBXTPXDTIGBLD-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|