C23H25NO3 — CID 135497712
2-(1-hydroxy-2-phenylethylidene)-3-(3-methoxyphenyl)imino-5,5-dimethylcyclohexan-1-one (PubChem CID 135497712) has the molecular formula C23H25NO3 and a molecular weight of 363.46 g/mol. Its IUPAC name is 2-(1-hydroxy-2-phenylethylidene)-3-(3-methoxyphenyl)imino-5,5-dimethylcyclohexan-1-one.
| Compound Name | 2-(1-hydroxy-2-phenylethylidene)-3-(3-methoxyphenyl)imino-5,5-dimethylcyclohexan-1-one |
|---|---|
| PubChem CID | 135497712 |
| Molecular Formula | C23H25NO3 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | 2-(1-hydroxy-2-phenylethylidene)-3-(3-methoxyphenyl)imino-5,5-dimethylcyclohexan-1-one |
| SMILES | COc1cccc(/N=C2\CC(C)(C)CC(=O)C2=C(O)Cc2ccccc2)c1 |
| InChI | InChI=1S/C23H25NO3/c1-23(2)14-19(24-17-10-7-11-18(13-17)27-3)22(21(26)15-23)20(25)12-16-8-5-4-6-9-16/h4-11,13,25H,12,14-15H2,1-3H3/b22-20?,24-19+ |
| InChIKey | XGGLDXWCGMCHCP-KNRYKOOVSA-N |
| XLogP | 5.21 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|