C24H27NO3 — CID 135622882
(2E,5S)-2-(1-hydroxypentylidene)-3-(4-methoxyphenyl)imino-5-phenylcyclohexan-1-one (PubChem CID 135622882) has the molecular formula C24H27NO3 and a molecular weight of 377.48 g/mol. Its IUPAC name is (2E,5S)-2-(1-hydroxypentylidene)-3-(4-methoxyphenyl)imino-5-phenylcyclohexan-1-one.
| Compound Name | (2E,5S)-2-(1-hydroxypentylidene)-3-(4-methoxyphenyl)imino-5-phenylcyclohexan-1-one |
|---|---|
| PubChem CID | 135622882 |
| Molecular Formula | C24H27NO3 |
| Molecular Weight | 377.48 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | (2E,5S)-2-(1-hydroxypentylidene)-3-(4-methoxyphenyl)imino-5-phenylcyclohexan-1-one |
| SMILES | CCCC/C(O)=C1\C(=O)C[C@@H](c2ccccc2)C\C1=N/c1ccc(OC)cc1 |
| InChI | InChI=1S/C24H27NO3/c1-3-4-10-22(26)24-21(25-19-11-13-20(28-2)14-12-19)15-18(16-23(24)27)17-8-6-5-7-9-17/h5-9,11-14,18,26H,3-4,10,15-16H2,1-2H3/b24-22+,25-21+/t18-/m0/s1 |
| InChIKey | YWZXPBQKPHIETH-QYJOBANUSA-N |
| XLogP | 5.92 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.48 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|