C26H24N2O6 — CID 136749205
2-[[(5S)-2-[4-(1,3-dioxoisoindol-2-yl)-1-hydroxybutylidene]-3-oxo-5-phenylcyclohexylidene]amino]acetic acid (PubChem CID 136749205) has the molecular formula C26H24N2O6 and a molecular weight of 460.49 g/mol. Its IUPAC name is 2-[[(5S)-2-[4-(1,3-dioxoisoindol-2-yl)-1-hydroxybutylidene]-3-oxo-5-phenylcyclohexylidene]amino]acetic acid.
| Compound Name | 2-[[(5S)-2-[4-(1,3-dioxoisoindol-2-yl)-1-hydroxybutylidene]-3-oxo-5-phenylcyclohexylidene]amino]acetic acid |
|---|---|
| PubChem CID | 136749205 |
| Molecular Formula | C26H24N2O6 |
| Molecular Weight | 460.49 g/mol |
| Exact Mass | 460.16 |
| IUPAC Name | 2-[[(5S)-2-[4-(1,3-dioxoisoindol-2-yl)-1-hydroxybutylidene]-3-oxo-5-phenylcyclohexylidene]amino]acetic acid |
| SMILES | O=C(O)C/N=C1\C[C@H](c2ccccc2)CC(=O)C1=C(O)CCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C26H24N2O6/c29-21(11-6-12-28-25(33)18-9-4-5-10-19(18)26(28)34)24-20(27-15-23(31)32)13-17(14-22(24)30)16-7-2-1-3-8-16/h1-5,7-10,17,29H,6,11-15H2,(H,31,32)/b24-21?,27-20+/t17-/m0/s1 |
| InChIKey | ZFEFARUSNJULQY-JHWKOGMCSA-N |
| XLogP | 3.55 |
| TPSA | 124.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.49 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|