C25H26N2O5S — CID 90591485
2-[4-[3-(benzenesulfonyl)-8-azabicyclo[3.2.1]octan-8-yl]-4-oxobutyl]isoindole-1,3-dione (PubChem CID 90591485) has the molecular formula C25H26N2O5S and a molecular weight of 466.56 g/mol. Its IUPAC name is 2-[4-[3-(benzenesulfonyl)-8-azabicyclo[3.2.1]octan-8-yl]-4-oxobutyl]isoindole-1,3-dione.
| Compound Name | 2-[4-[3-(benzenesulfonyl)-8-azabicyclo[3.2.1]octan-8-yl]-4-oxobutyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 90591485 |
| Molecular Formula | C25H26N2O5S |
| Molecular Weight | 466.56 g/mol |
| Exact Mass | 466.16 |
| IUPAC Name | 2-[4-[3-(benzenesulfonyl)-8-azabicyclo[3.2.1]octan-8-yl]-4-oxobutyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CCCC(=O)N1C2CCC1CC(S(=O)(=O)c1ccccc1)C2 |
| InChI | InChI=1S/C25H26N2O5S/c28-23(11-6-14-26-24(29)21-9-4-5-10-22(21)25(26)30)27-17-12-13-18(27)16-20(15-17)33(31,32)19-7-2-1-3-8-19/h1-5,7-10,17-18,20H,6,11-16H2 |
| InChIKey | VSNZOMDCVXBSMF-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 91.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.56 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|