C22H21FN2O5S — CID 90589734
2-[3-[4-(4-fluorophenyl)sulfonylpiperidin-1-yl]-3-oxopropyl]isoindole-1,3-dione (PubChem CID 90589734) has the molecular formula C22H21FN2O5S and a molecular weight of 444.48 g/mol. Its IUPAC name is 2-[3-[4-(4-fluorophenyl)sulfonylpiperidin-1-yl]-3-oxopropyl]isoindole-1,3-dione.
| Compound Name | 2-[3-[4-(4-fluorophenyl)sulfonylpiperidin-1-yl]-3-oxopropyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 90589734 |
| Molecular Formula | C22H21FN2O5S |
| Molecular Weight | 444.48 g/mol |
| Exact Mass | 444.12 |
| IUPAC Name | 2-[3-[4-(4-fluorophenyl)sulfonylpiperidin-1-yl]-3-oxopropyl]isoindole-1,3-dione |
| SMILES | O=C(CCN1C(=O)c2ccccc2C1=O)N1CCC(S(=O)(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C22H21FN2O5S/c23-15-5-7-16(8-6-15)31(29,30)17-9-12-24(13-10-17)20(26)11-14-25-21(27)18-3-1-2-4-19(18)22(25)28/h1-8,17H,9-14H2 |
| InChIKey | BTTWPXPZXPJYEF-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 91.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.48 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|