C11H12BF3O3 — CID 54243682
[2,2-dimethyl-6-(trifluoromethyl)-3H-1-benzofuran-4-yl]boronic acid (PubChem CID 54243682) has the molecular formula C11H12BF3O3 and a molecular weight of 260.02 g/mol. Its IUPAC name is [2,2-dimethyl-6-(trifluoromethyl)-3H-1-benzofuran-4-yl]boronic acid.
| Compound Name | [2,2-dimethyl-6-(trifluoromethyl)-3H-1-benzofuran-4-yl]boronic acid |
|---|---|
| PubChem CID | 54243682 |
| Molecular Formula | C11H12BF3O3 |
| Molecular Weight | 260.02 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | [2,2-dimethyl-6-(trifluoromethyl)-3H-1-benzofuran-4-yl]boronic acid |
| SMILES | CC1(C)Cc2c(cc(C(F)(F)F)cc2B(O)O)O1 |
| InChI | InChI=1S/C11H12BF3O3/c1-10(2)5-7-8(12(16)17)3-6(11(13,14)15)4-9(7)18-10/h3-4,16-17H,5H2,1-2H3 |
| InChIKey | QRTQWZOWMVKHRA-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.02 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|