C14H13F3O2 — CID 87544242
(2E)-2-[2,2-dimethyl-7-(trifluoromethyl)-3H-chromen-4-ylidene]acetaldehyde (PubChem CID 87544242) has the molecular formula C14H13F3O2 and a molecular weight of 270.25 g/mol. Its IUPAC name is (2E)-2-[2,2-dimethyl-7-(trifluoromethyl)-3H-chromen-4-ylidene]acetaldehyde.
| Compound Name | (2E)-2-[2,2-dimethyl-7-(trifluoromethyl)-3H-chromen-4-ylidene]acetaldehyde |
|---|---|
| PubChem CID | 87544242 |
| Molecular Formula | C14H13F3O2 |
| Molecular Weight | 270.25 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | (2E)-2-[2,2-dimethyl-7-(trifluoromethyl)-3H-chromen-4-ylidene]acetaldehyde |
| SMILES | CC1(C)C/C(=C\C=O)c2ccc(C(F)(F)F)cc2O1 |
| InChI | InChI=1S/C14H13F3O2/c1-13(2)8-9(5-6-18)11-4-3-10(14(15,16)17)7-12(11)19-13/h3-7H,8H2,1-2H3/b9-5+ |
| InChIKey | OIIQSDYFOIILKZ-WEVVVXLNSA-N |
| XLogP | 3.85 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.25 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|