About [(2E)-2-[2,2-dimethyl-7-(trifluoromethyl)-3H-chromen-4-ylidene]ethyl] acetate
[(2E)-2-[2,2-dimethyl-7-(trifluoromethyl)-3H-chromen-4-ylidene]ethyl] acetate (PubChem CID 68703865) has the molecular formula C16H17F3O3
and a molecular weight of 314.30 g/mol. Its IUPAC name is [(2E)-2-[2,2-dimethyl-7-(trifluoromethyl)-3H-chromen-4-ylidene]ethyl] acetate.
Molecular Properties
| Compound Name | [(2E)-2-[2,2-dimethyl-7-(trifluoromethyl)-3H-chromen-4-ylidene]ethyl] acetate |
| PubChem CID | 68703865 |
| Molecular Formula | C16H17F3O3 |
| Molecular Weight | 314.30 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | [(2E)-2-[2,2-dimethyl-7-(trifluoromethyl)-3H-chromen-4-ylidene]ethyl] acetate |
| SMILES | CC(=O)OC/C=C1\CC(C)(C)Oc2cc(C(F)(F)F)ccc21 |
| InChI | InChI=1S/C16H17F3O3/c1-10(20)21-7-6-11-9-15(2,3)22-14-8-12(16(17,18)19)4-5-13(11)14/h4-6,8H,7,9H2,1-3H3/b11-6+ |
| InChIKey | XGCDGVMHRRVNPA-IZZDOVSWSA-N |
| XLogP | 4.21 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.30 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(2E)-2-[2,2-dimethyl-7-(trifluoromethyl)-3H-chromen-4-ylidene]ethyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2E)-2-[2,2-dimethyl-7-(trifluoromethyl)-3H-chromen-4-ylidene]ethyl] acetate?
The IUPAC name of [(2E)-2-[2,2-dimethyl-7-(trifluoromethyl)-3H-chromen-4-ylidene]ethyl] acetate (CID 68703865) is [(2E)-2-[2,2-dimethyl-7-(trifluoromethyl)-3H-chromen-4-ylidene]ethyl] acetate.
What is the SMILES notation for [(2E)-2-[2,2-dimethyl-7-(trifluoromethyl)-3H-chromen-4-ylidene]ethyl] acetate?
The canonical SMILES for [(2E)-2-[2,2-dimethyl-7-(trifluoromethyl)-3H-chromen-4-ylidene]ethyl] acetate is CC(=O)OC/C=C1\CC(C)(C)Oc2cc(C(F)(F)F)ccc21.
What is the InChIKey of [(2E)-2-[2,2-dimethyl-7-(trifluoromethyl)-3H-chromen-4-ylidene]ethyl] acetate?
The InChIKey is XGCDGVMHRRVNPA-IZZDOVSWSA-N. The full InChI is InChI=1S/C16H17F3O3/c1-10(20)21-7-6-11-9-15(2,3)22-14-8-12(16(17,18)19)4-5-13(11)14/h4-6,8H,7,9H2,1-3H3/b11-6+.
What are the key properties of [(2E)-2-[2,2-dimethyl-7-(trifluoromethyl)-3H-chromen-4-ylidene]ethyl] acetate?
[(2E)-2-[2,2-dimethyl-7-(trifluoromethyl)-3H-chromen-4-ylidene]ethyl] acetate has a molecular weight of 314.30 g/mol, XLogP of 4.21, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2E)-2-[2,2-dimethyl-7-(trifluoromethyl)-3H-chromen-4-ylidene]ethyl] acetate is sourced from PubChem (CID 68703865), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).