C7H8N4O — CID 67777070
(7S)-7-methyl-7,8-dihydro-5H-pteridin-6-one (PubChem CID 67777070) has the molecular formula C7H8N4O and a molecular weight of 164.17 g/mol. Its IUPAC name is (7S)-7-methyl-7,8-dihydro-5H-pteridin-6-one.
| Compound Name | (7S)-7-methyl-7,8-dihydro-5H-pteridin-6-one |
|---|---|
| PubChem CID | 67777070 |
| Molecular Formula | C7H8N4O |
| Molecular Weight | 164.17 g/mol |
| Exact Mass | 164.07 |
| IUPAC Name | (7S)-7-methyl-7,8-dihydro-5H-pteridin-6-one |
| SMILES | C[C@@H]1Nc2ncncc2NC1=O |
| InChI | InChI=1S/C7H8N4O/c1-4-7(12)11-5-2-8-3-9-6(5)10-4/h2-4H,1H3,(H,11,12)(H,8,9,10)/t4-/m0/s1 |
| InChIKey | VLBKSFFDAWLLFB-BYPYZUCNSA-N |
| XLogP | 0.23 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.17 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |