C5H5N3OS — CID 175215147
1,2-dihydro-[1,3]thiazolo[5,4-d]pyrimidin-2-ol (PubChem CID 175215147) has the molecular formula C5H5N3OS and a molecular weight of 155.18 g/mol. Its IUPAC name is 1,2-dihydro-[1,3]thiazolo[5,4-d]pyrimidin-2-ol.
| Compound Name | 1,2-dihydro-[1,3]thiazolo[5,4-d]pyrimidin-2-ol |
|---|---|
| PubChem CID | 175215147 |
| Molecular Formula | C5H5N3OS |
| Molecular Weight | 155.18 g/mol |
| Exact Mass | 155.02 |
| IUPAC Name | 1,2-dihydro-[1,3]thiazolo[5,4-d]pyrimidin-2-ol |
| SMILES | OC1Nc2cncnc2S1 |
| InChI | InChI=1S/C5H5N3OS/c9-5-8-3-1-6-2-7-4(3)10-5/h1-2,5,8-9H |
| InChIKey | IRNQNEIXRUFDRM-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.18 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |