C8H8N4OS — CID 165349518
8,9-dihydro-7H-purino[8,9-b][1,3]thiazin-8-ol (PubChem CID 165349518) has the molecular formula C8H8N4OS and a molecular weight of 208.25 g/mol. Its IUPAC name is 8,9-dihydro-7H-purino[8,9-b][1,3]thiazin-8-ol.
| Compound Name | 8,9-dihydro-7H-purino[8,9-b][1,3]thiazin-8-ol |
|---|---|
| PubChem CID | 165349518 |
| Molecular Formula | C8H8N4OS |
| Molecular Weight | 208.25 g/mol |
| Exact Mass | 208.04 |
| IUPAC Name | 8,9-dihydro-7H-purino[8,9-b][1,3]thiazin-8-ol |
| SMILES | OC1CSc2nc3cncnc3n2C1 |
| InChI | InChI=1S/C8H8N4OS/c13-5-2-12-7-6(1-9-4-10-7)11-8(12)14-3-5/h1,4-5,13H,2-3H2 |
| InChIKey | WLSJKBPQPJJOHQ-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.25 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |