About 2-chloro-1H-thiadiazolo[5,4-d]pyrimidine
2-chloro-1H-thiadiazolo[5,4-d]pyrimidine (PubChem CID 22719619) has the molecular formula C4H3ClN4S
and a molecular weight of 174.62 g/mol. Its IUPAC name is 2-chloro-1H-thiadiazolo[5,4-d]pyrimidine.
Molecular Properties
| Compound Name | 2-chloro-1H-thiadiazolo[5,4-d]pyrimidine |
| PubChem CID | 22719619 |
| Molecular Formula | C4H3ClN4S |
| Molecular Weight | 174.62 g/mol |
| Exact Mass | 173.98 |
| IUPAC Name | 2-chloro-1H-thiadiazolo[5,4-d]pyrimidine |
| SMILES | ClN1Nc2cncnc2S1 |
| InChI | InChI=1S/C4H3ClN4S/c5-9-8-3-1-6-2-7-4(3)10-9/h1-2,8H |
| InChIKey | JLVWYDBAKTYZPH-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.62 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-1H-thiadiazolo[5,4-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-1H-thiadiazolo[5,4-d]pyrimidine?
The IUPAC name of 2-chloro-1H-thiadiazolo[5,4-d]pyrimidine (CID 22719619) is 2-chloro-1H-thiadiazolo[5,4-d]pyrimidine.
What is the SMILES notation for 2-chloro-1H-thiadiazolo[5,4-d]pyrimidine?
The canonical SMILES for 2-chloro-1H-thiadiazolo[5,4-d]pyrimidine is ClN1Nc2cncnc2S1.
What is the InChIKey of 2-chloro-1H-thiadiazolo[5,4-d]pyrimidine?
The InChIKey is JLVWYDBAKTYZPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H3ClN4S/c5-9-8-3-1-6-2-7-4(3)10-9/h1-2,8H.
What are the key properties of 2-chloro-1H-thiadiazolo[5,4-d]pyrimidine?
2-chloro-1H-thiadiazolo[5,4-d]pyrimidine has a molecular weight of 174.62 g/mol, XLogP of 1.28, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-1H-thiadiazolo[5,4-d]pyrimidine is sourced from PubChem (CID 22719619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).