C7H5N3O2 — CID 69034337
1H-pyrimido[5,4-c]oxazepin-3-one (PubChem CID 69034337) has the molecular formula C7H5N3O2 and a molecular weight of 163.14 g/mol. Its IUPAC name is 1H-pyrimido[5,4-c]oxazepin-3-one.
| Compound Name | 1H-pyrimido[5,4-c]oxazepin-3-one |
|---|---|
| PubChem CID | 69034337 |
| Molecular Formula | C7H5N3O2 |
| Molecular Weight | 163.14 g/mol |
| Exact Mass | 163.04 |
| IUPAC Name | 1H-pyrimido[5,4-c]oxazepin-3-one |
| SMILES | O=C1C=Cc2ncncc2NO1 |
| InChI | InChI=1S/C7H5N3O2/c11-7-2-1-5-6(10-12-7)3-8-4-9-5/h1-4,10H |
| InChIKey | GHGLDVYEWBLPJO-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.14 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |