About pyrimido[4,5-g]quinazoline-5,10-dione
pyrimido[4,5-g]quinazoline-5,10-dione (PubChem CID 151510286) has the molecular formula C10H4N4O2
and a molecular weight of 212.17 g/mol. Its IUPAC name is pyrimido[4,5-g]quinazoline-5,10-dione.
Molecular Properties
| Compound Name | pyrimido[4,5-g]quinazoline-5,10-dione |
| PubChem CID | 151510286 |
| Molecular Formula | C10H4N4O2 |
| Molecular Weight | 212.17 g/mol |
| Exact Mass | 212.03 |
| IUPAC Name | pyrimido[4,5-g]quinazoline-5,10-dione |
| SMILES | O=C1c2cncnc2C(=O)c2cncnc21 |
| InChI | InChI=1S/C10H4N4O2/c15-9-5-1-11-3-13-7(5)10(16)6-2-12-4-14-8(6)9/h1-4H |
| InChIKey | PSHRYQRMHCFSOZ-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 85.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.17 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze pyrimido[4,5-g]quinazoline-5,10-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrimido[4,5-g]quinazoline-5,10-dione?
The IUPAC name of pyrimido[4,5-g]quinazoline-5,10-dione (CID 151510286) is pyrimido[4,5-g]quinazoline-5,10-dione.
What is the SMILES notation for pyrimido[4,5-g]quinazoline-5,10-dione?
The canonical SMILES for pyrimido[4,5-g]quinazoline-5,10-dione is O=C1c2cncnc2C(=O)c2cncnc21.
What is the InChIKey of pyrimido[4,5-g]quinazoline-5,10-dione?
The InChIKey is PSHRYQRMHCFSOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H4N4O2/c15-9-5-1-11-3-13-7(5)10(16)6-2-12-4-14-8(6)9/h1-4H.
What are the key properties of pyrimido[4,5-g]quinazoline-5,10-dione?
pyrimido[4,5-g]quinazoline-5,10-dione has a molecular weight of 212.17 g/mol, XLogP of 0.04, 0 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for pyrimido[4,5-g]quinazoline-5,10-dione is sourced from PubChem (CID 151510286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).