C10H4N4O2 — CID 151510286
pyrimido[4,5-g]quinazoline-5,10-dione (PubChem CID 151510286) has the molecular formula C10H4N4O2 and a molecular weight of 212.17 g/mol. Its IUPAC name is pyrimido[4,5-g]quinazoline-5,10-dione.
| Compound Name | pyrimido[4,5-g]quinazoline-5,10-dione |
|---|---|
| PubChem CID | 151510286 |
| Molecular Formula | C10H4N4O2 |
| Molecular Weight | 212.17 g/mol |
| Exact Mass | 212.03 |
| IUPAC Name | pyrimido[4,5-g]quinazoline-5,10-dione |
| SMILES | O=C1c2cncnc2C(=O)c2cncnc21 |
| InChI | InChI=1S/C10H4N4O2/c15-9-5-1-11-3-13-7(5)10(16)6-2-12-4-14-8(6)9/h1-4H |
| InChIKey | PSHRYQRMHCFSOZ-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 85.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.17 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|